C21H21N3O3 — CID 155804068
N-(2-hydroxyphenyl)-2-[(2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]acetamide (PubChem CID 155804068) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-2-[(2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]acetamide.
| Compound Name | N-(2-hydroxyphenyl)-2-[(2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 155804068 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-(2-hydroxyphenyl)-2-[(2-hydroxyphenyl)methyl-(pyridin-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(Cc1ccccn1)Cc1ccccc1O)Nc1ccccc1O |
| InChI | InChI=1S/C21H21N3O3/c25-19-10-3-1-7-16(19)13-24(14-17-8-5-6-12-22-17)15-21(27)23-18-9-2-4-11-20(18)26/h1-12,25-26H,13-15H2,(H,23,27) |
| InChIKey | JWDWHVPZANJAMH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|