C23H26N2O5Si — CID 155804190
6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-(3-trimethylsilylprop-2-ynyl)quinazoline-2,4-dione (PubChem CID 155804190) has the molecular formula C23H26N2O5Si and a molecular weight of 438.56 g/mol. Its IUPAC name is 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-(3-trimethylsilylprop-2-ynyl)quinazoline-2,4-dione.
| Compound Name | 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-(3-trimethylsilylprop-2-ynyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 155804190 |
| Molecular Formula | C23H26N2O5Si |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-(3-trimethylsilylprop-2-ynyl)quinazoline-2,4-dione |
| SMILES | Cc1c(C(O)=C2C(=O)CCCC2=O)ccc2c1c(=O)n(CC#C[Si](C)(C)C)c(=O)n2C |
| InChI | InChI=1S/C23H26N2O5Si/c1-14-15(21(28)20-17(26)8-6-9-18(20)27)10-11-16-19(14)22(29)25(23(30)24(16)2)12-7-13-31(3,4)5/h10-11,28H,6,8-9,12H2,1-5H3 |
| InChIKey | JIBXIUJQTARSAT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|