C16H22 — CID 155804319
(1E,5Z)-1-[(1E,5Z)-cycloocta-1,5-dien-1-yl]cycloocta-1,5-diene (PubChem CID 155804319) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is (1E,5Z)-1-[(1E,5Z)-cycloocta-1,5-dien-1-yl]cycloocta-1,5-diene.
| Compound Name | (1E,5Z)-1-[(1E,5Z)-cycloocta-1,5-dien-1-yl]cycloocta-1,5-diene |
|---|---|
| PubChem CID | 155804319 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (1E,5Z)-1-[(1E,5Z)-cycloocta-1,5-dien-1-yl]cycloocta-1,5-diene |
| SMILES | C1=C\CCC(/C2=C/CC/C=C\CC2)=C\CC/1 |
| InChI | InChI=1S/C16H22/c1-3-7-11-15(12-8-4-1)16-13-9-5-2-6-10-14-16/h1-3,5,12,14H,4,6-11,13H2/b3-1-,5-2-,15-12+,16-14+ |
| InChIKey | HDKWYWCKRNPHEW-NHGNIBMPSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|