About CID 155804412
CID 155804412 (PubChem CID 155804412) has the molecular formula C20H15F2N4Pt-2
and a molecular weight of 544.44 g/mol.
Molecular Properties
| Compound Name | CID 155804412 |
| PubChem CID | 155804412 |
| Molecular Formula | C20H15F2N4Pt-2 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | — |
| SMILES | CN1[C-]N(c2ccccn2)C=C1.Fc1c[c-]c(-c2ccccn2)c(F)c1.[Pt] |
| InChI | InChI=1S/C11H6F2N.C9H9N3.Pt/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;1-11-6-7-12(8-11)9-4-2-3-5-10-9;/h1-4,6-7H;2-7H,1H3;/q2*-1; |
| InChIKey | PFPZOJRAVIDDKD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 155804412 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155804412?
The IUPAC name of CID 155804412 (CID 155804412) is not available.
What is the SMILES notation for CID 155804412?
The canonical SMILES for CID 155804412 is CN1[C-]N(c2ccccn2)C=C1.Fc1c[c-]c(-c2ccccn2)c(F)c1.[Pt].
What is the InChIKey of CID 155804412?
The InChIKey is PFPZOJRAVIDDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F2N.C9H9N3.Pt/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;1-11-6-7-12(8-11)9-4-2-3-5-10-9;/h1-4,6-7H;2-7H,1H3;/q2*-1;.
What are the key properties of CID 155804412?
CID 155804412 has a molecular weight of 544.44 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155804412 is sourced from PubChem (CID 155804412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).