C40H68 — CID 155804418
(6E,10E,14E,18E,22E,26E,30R)-2,6,10,14,18,22,26,30-octamethyldotriaconta-2,6,10,14,18,22,26-heptaene (PubChem CID 155804418) has the molecular formula C40H68 and a molecular weight of 548.98 g/mol. Its IUPAC name is (6E,10E,14E,18E,22E,26E,30R)-2,6,10,14,18,22,26,30-octamethyldotriaconta-2,6,10,14,18,22,26-heptaene.
| Compound Name | (6E,10E,14E,18E,22E,26E,30R)-2,6,10,14,18,22,26,30-octamethyldotriaconta-2,6,10,14,18,22,26-heptaene |
|---|---|
| PubChem CID | 155804418 |
| Molecular Formula | C40H68 |
| Molecular Weight | 548.98 g/mol |
| Exact Mass | 548.53 |
| IUPAC Name | (6E,10E,14E,18E,22E,26E,30R)-2,6,10,14,18,22,26,30-octamethyldotriaconta-2,6,10,14,18,22,26-heptaene |
| SMILES | CC[C@@H](C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C40H68/c1-11-34(4)20-13-22-36(6)24-15-26-38(8)28-17-30-40(10)32-18-31-39(9)29-16-27-37(7)25-14-23-35(5)21-12-19-33(2)3/h19,22-23,26-27,30-31,34H,11-18,20-21,24-25,28-29,32H2,1-10H3/b35-23+,36-22+,37-27+,38-26+,39-31+,40-30+/t34-/m1/s1 |
| InChIKey | NNAMSNGZQLVMQY-GAPQENEMSA-N |
| XLogP | 14.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.98 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|