C40H78O — CID 155804487
(6R,10S,14R,19R,23S,24E,27S,28E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-24,28-dien-2-ol (PubChem CID 155804487) has the molecular formula C40H78O and a molecular weight of 575.06 g/mol. Its IUPAC name is (6R,10S,14R,19R,23S,24E,27S,28E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-24,28-dien-2-ol.
| Compound Name | (6R,10S,14R,19R,23S,24E,27S,28E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-24,28-dien-2-ol |
|---|---|
| PubChem CID | 155804487 |
| Molecular Formula | C40H78O |
| Molecular Weight | 575.06 g/mol |
| Exact Mass | 574.61 |
| IUPAC Name | (6R,10S,14R,19R,23S,24E,27S,28E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-24,28-dien-2-ol |
| SMILES | CC(C)C/C=C/[C@@H](C)C/C=C/[C@@H](C)CCC[C@H](C)CCCC[C@@H](C)CCC[C@H](C)CCC[C@@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C40H78O/c1-33(2)19-13-22-36(5)25-16-28-37(6)26-14-23-34(3)20-11-12-21-35(4)24-15-27-38(7)29-17-30-39(8)31-18-32-40(9,10)41/h13,16,22,28,33-39,41H,11-12,14-15,17-21,23-27,29-32H2,1-10H3/b22-13+,28-16+/t34-,35-,36-,37+,38+,39-/m1/s1 |
| InChIKey | NKXXNXZGYNRQNV-BTRAWPHCSA-N |
| XLogP | 13.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.06 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|