About 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine
6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine (PubChem CID 155804527) has the molecular formula C17H22N6O3
and a molecular weight of 358.40 g/mol. Its IUPAC name is 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine.
Molecular Properties
| Compound Name | 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine |
| PubChem CID | 155804527 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine |
| SMILES | Cc1ccnc(Nc2ccc([N+](=O)[O-])c(NCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C17H22N6O3/c1-13-4-5-18-16(12-13)20-15-3-2-14(23(24)25)17(21-15)19-6-7-22-8-10-26-11-9-22/h2-5,12H,6-11H2,1H3,(H2,18,19,20,21) |
| InChIKey | OAEWOLLUOVFYIT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine?
The IUPAC name of 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine (CID 155804527) is 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine.
What is the SMILES notation for 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine?
The canonical SMILES for 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine is Cc1ccnc(Nc2ccc([N+](=O)[O-])c(NCCN3CCOCC3)n2)c1.
What is the InChIKey of 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine?
The InChIKey is OAEWOLLUOVFYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N6O3/c1-13-4-5-18-16(12-13)20-15-3-2-14(23(24)25)17(21-15)19-6-7-22-8-10-26-11-9-22/h2-5,12H,6-11H2,1H3,(H2,18,19,20,21).
What are the key properties of 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine?
6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine has a molecular weight of 358.40 g/mol, XLogP of 2.18, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-(4-methyl-2-pyridinyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine is sourced from PubChem (CID 155804527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).