C26H48O7P2 — CID 155804591
[hydroxy(methoxy)phosphoryl] [(3R,6Z,10E,14E)-3,7,11,15,19-pentamethylicosa-6,10,14,18-tetraenyl] hydrogen phosphate (PubChem CID 155804591) has the molecular formula C26H48O7P2 and a molecular weight of 534.61 g/mol. Its IUPAC name is [hydroxy(methoxy)phosphoryl] [(3R,6Z,10E,14E)-3,7,11,15,19-pentamethylicosa-6,10,14,18-tetraenyl] hydrogen phosphate.
| Compound Name | [hydroxy(methoxy)phosphoryl] [(3R,6Z,10E,14E)-3,7,11,15,19-pentamethylicosa-6,10,14,18-tetraenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 155804591 |
| Molecular Formula | C26H48O7P2 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | [hydroxy(methoxy)phosphoryl] [(3R,6Z,10E,14E)-3,7,11,15,19-pentamethylicosa-6,10,14,18-tetraenyl] hydrogen phosphate |
| SMILES | COP(=O)(O)OP(=O)(O)OCC[C@H](C)CC/C=C(/C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H48O7P2/c1-22(2)12-8-13-23(3)14-9-15-24(4)16-10-17-25(5)18-11-19-26(6)20-21-32-35(29,30)33-34(27,28)31-7/h12,14,16,18,26H,8-11,13,15,17,19-21H2,1-7H3,(H,27,28)(H,29,30)/b23-14+,24-16+,25-18-/t26-/m1/s1 |
| InChIKey | GDOCHZBDTMOKKR-FEJNUDJDSA-N |
| XLogP | 8.82 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|