About 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane
5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane (PubChem CID 155804930) has the molecular formula C9H18N4O2
and a molecular weight of 214.27 g/mol. Its IUPAC name is 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane.
Molecular Properties
| Compound Name | 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane |
| PubChem CID | 155804930 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane |
| SMILES | C.CCn1c(N)c(N)c(=O)n(CC)c1=O |
| InChI | InChI=1S/C8H14N4O2.CH4/c1-3-11-6(10)5(9)7(13)12(4-2)8(11)14;/h3-4,9-10H2,1-2H3;1H4 |
| InChIKey | DLYCHDWPBUVORA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane?
The IUPAC name of 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane (CID 155804930) is 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane.
What is the SMILES notation for 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane?
The canonical SMILES for 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane is C.CCn1c(N)c(N)c(=O)n(CC)c1=O.
What is the InChIKey of 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane?
The InChIKey is DLYCHDWPBUVORA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2.CH4/c1-3-11-6(10)5(9)7(13)12(4-2)8(11)14;/h3-4,9-10H2,1-2H3;1H4.
What are the key properties of 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane?
5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane has a molecular weight of 214.27 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diamino-1,3-diethylpyrimidine-2,4-dione;methane is sourced from PubChem (CID 155804930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).