About 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole
5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 155804973) has the molecular formula C23H18N4O3S2
and a molecular weight of 462.56 g/mol. Its IUPAC name is 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole |
| PubChem CID | 155804973 |
| Molecular Formula | C23H18N4O3S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | CS(=O)(=O)c1nccc(-c2c(-c3cccc(OCc4ccccc4)c3)nc3sccn23)n1 |
| InChI | InChI=1S/C23H18N4O3S2/c1-32(28,29)22-24-11-10-19(25-22)21-20(26-23-27(21)12-13-31-23)17-8-5-9-18(14-17)30-15-16-6-3-2-4-7-16/h2-14H,15H2,1H3 |
| InChIKey | DQOWVAQFOQHAFL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole?
The IUPAC name of 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole (CID 155804973) is 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole is CS(=O)(=O)c1nccc(-c2c(-c3cccc(OCc4ccccc4)c3)nc3sccn23)n1.
What is the InChIKey of 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole?
The InChIKey is DQOWVAQFOQHAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N4O3S2/c1-32(28,29)22-24-11-10-19(25-22)21-20(26-23-27(21)12-13-31-23)17-8-5-9-18(14-17)30-15-16-6-3-2-4-7-16/h2-14H,15H2,1H3.
What are the key properties of 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole?
5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole has a molecular weight of 462.56 g/mol, XLogP of 4.50, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylsulfonylpyrimidin-4-yl)-6-(3-phenylmethoxyphenyl)imidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 155804973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).