About [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol
[2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol (PubChem CID 155804988) has the molecular formula C16H16ClF2NO
and a molecular weight of 311.76 g/mol. Its IUPAC name is [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol.
Molecular Properties
| Compound Name | [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol |
| PubChem CID | 155804988 |
| Molecular Formula | C16H16ClF2NO |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol |
| SMILES | CCN(Cc1cc(F)ccc1F)c1ccc(CO)c(Cl)c1 |
| InChI | InChI=1S/C16H16ClF2NO/c1-2-20(9-12-7-13(18)4-6-16(12)19)14-5-3-11(10-21)15(17)8-14/h3-8,21H,2,9-10H2,1H3 |
| InChIKey | PMGJIRVEXVITHE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol?
The IUPAC name of [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol (CID 155804988) is [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol.
What is the SMILES notation for [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol?
The canonical SMILES for [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol is CCN(Cc1cc(F)ccc1F)c1ccc(CO)c(Cl)c1.
What is the InChIKey of [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol?
The InChIKey is PMGJIRVEXVITHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClF2NO/c1-2-20(9-12-7-13(18)4-6-16(12)19)14-5-3-11(10-21)15(17)8-14/h3-8,21H,2,9-10H2,1H3.
What are the key properties of [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol?
[2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol has a molecular weight of 311.76 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-4-[(2,5-difluorophenyl)methyl-ethylamino]phenyl]methanol is sourced from PubChem (CID 155804988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).