C11H10N4O3 — CID 155805008
N-[2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)phenyl]acetamide (PubChem CID 155805008) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is N-[2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)phenyl]acetamide.
| Compound Name | N-[2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 155805008 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-[2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1-c1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H10N4O3/c1-6(16)12-8-5-3-2-4-7(8)9-10(17)13-11(18)15-14-9/h2-5H,1H3,(H,12,16)(H2,13,15,17,18) |
| InChIKey | RMHJBLNPDKJEBF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |