C16H14N4O2 — CID 155805048
13,14-dimethoxy-1,6,8-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2(7),3,5,8,10,12,14,16-octaen-9-amine (PubChem CID 155805048) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 13,14-dimethoxy-1,6,8-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2(7),3,5,8,10,12,14,16-octaen-9-amine.
| Compound Name | 13,14-dimethoxy-1,6,8-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2(7),3,5,8,10,12,14,16-octaen-9-amine |
|---|---|
| PubChem CID | 155805048 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 13,14-dimethoxy-1,6,8-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-2(7),3,5,8,10,12,14,16-octaen-9-amine |
| SMILES | COc1cc2cn3c4cccnc4nc(N)c3c2cc1OC |
| InChI | InChI=1S/C16H14N4O2/c1-21-12-6-9-8-20-11-4-3-5-18-16(11)19-15(17)14(20)10(9)7-13(12)22-2/h3-8H,1-2H3,(H2,17,18,19) |
| InChIKey | WYANURYGBOKVHG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |