About 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol
3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol (PubChem CID 155805116) has the molecular formula C22H13F2N3O
and a molecular weight of 373.36 g/mol. Its IUPAC name is 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol.
Molecular Properties
| Compound Name | 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol |
| PubChem CID | 155805116 |
| Molecular Formula | C22H13F2N3O |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccccc2c1/C=c1/ccc2c(c1)N=C(c1cc(F)cc(F)c1)N=2 |
| InChI | InChI=1S/C22H13F2N3O/c23-14-9-13(10-15(24)11-14)21-25-19-6-5-12(8-20(19)26-21)7-17-16-3-1-2-4-18(16)27-22(17)28/h1-11,27-28H/b12-7- |
| InChIKey | BINLOCIRCMPDJM-GHXNOFRVSA-N |
| XLogP | 3.69 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol?
The IUPAC name of 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol (CID 155805116) is 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol.
What is the SMILES notation for 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol?
The canonical SMILES for 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol is Oc1[nH]c2ccccc2c1/C=c1/ccc2c(c1)N=C(c1cc(F)cc(F)c1)N=2.
What is the InChIKey of 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol?
The InChIKey is BINLOCIRCMPDJM-GHXNOFRVSA-N. The full InChI is InChI=1S/C22H13F2N3O/c23-14-9-13(10-15(24)11-14)21-25-19-6-5-12(8-20(19)26-21)7-17-16-3-1-2-4-18(16)27-22(17)28/h1-11,27-28H/b12-7-.
What are the key properties of 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol?
3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol has a molecular weight of 373.36 g/mol, XLogP of 3.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-[2-(3,5-difluorophenyl)benzimidazol-5-ylidene]methyl]-1H-indol-2-ol is sourced from PubChem (CID 155805116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).