C22H35NO — CID 155805273
1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperidine (PubChem CID 155805273) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is 1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperidine.
| Compound Name | 1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperidine |
|---|---|
| PubChem CID | 155805273 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | 1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperidine |
| SMILES | C/C(=C\CCc1ccoc1)CC/C=C(\C)CCCN1CCCCC1 |
| InChI | InChI=1S/C22H35NO/c1-20(11-7-13-22-14-18-24-19-22)9-6-10-21(2)12-8-17-23-15-4-3-5-16-23/h10-11,14,18-19H,3-9,12-13,15-17H2,1-2H3/b20-11+,21-10+ |
| InChIKey | DYADDKWVRNKOBQ-QSXSYNPSSA-N |
| XLogP | 6.15 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|