About 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine
3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 155805320) has the molecular formula C18H12N4S
and a molecular weight of 316.39 g/mol. Its IUPAC name is 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 155805320 |
| Molecular Formula | C18H12N4S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1cnc2[nH]cc(-c3ccc(-c4c[nH]c5ncccc45)s3)c2c1 |
| InChI | InChI=1S/C18H12N4S/c1-3-11-13(9-21-17(11)19-7-1)15-5-6-16(23-15)14-10-22-18-12(14)4-2-8-20-18/h1-10H,(H,19,21)(H,20,22) |
| InChIKey | LGYXARXEQBJHGV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine (CID 155805320) is 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine is c1cnc2[nH]cc(-c3ccc(-c4c[nH]c5ncccc45)s3)c2c1.
What is the InChIKey of 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is LGYXARXEQBJHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N4S/c1-3-11-13(9-21-17(11)19-7-1)15-5-6-16(23-15)14-10-22-18-12(14)4-2-8-20-18/h1-10H,(H,19,21)(H,20,22).
What are the key properties of 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine?
3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 316.39 g/mol, XLogP of 4.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1H-pyrrolo[2,3-b]pyridin-3-yl)thiophen-2-yl]-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 155805320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).