About 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one
4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one (PubChem CID 155805378) has the molecular formula C26H26N2O3
and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one.
Molecular Properties
| Compound Name | 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one |
| PubChem CID | 155805378 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one |
| SMILES | COc1ccc(NCCCCN2C(=O)c3ccccc3OC=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-30-22-15-13-21(14-16-22)27-17-7-8-18-28-24(20-9-3-2-4-10-20)19-31-25-12-6-5-11-23(25)26(28)29/h2-6,9-16,19,27H,7-8,17-18H2,1H3 |
| InChIKey | BLCVGFCJQIIVNL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one?
The IUPAC name of 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one (CID 155805378) is 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one.
What is the SMILES notation for 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one?
The canonical SMILES for 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one is COc1ccc(NCCCCN2C(=O)c3ccccc3OC=C2c2ccccc2)cc1.
What is the InChIKey of 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one?
The InChIKey is BLCVGFCJQIIVNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N2O3/c1-30-22-15-13-21(14-16-22)27-17-7-8-18-28-24(20-9-3-2-4-10-20)19-31-25-12-6-5-11-23(25)26(28)29/h2-6,9-16,19,27H,7-8,17-18H2,1H3.
What are the key properties of 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one?
4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one has a molecular weight of 414.51 g/mol, XLogP of 5.42, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-methoxyanilino)butyl]-3-phenyl-1,4-benzoxazepin-5-one is sourced from PubChem (CID 155805378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).