About [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate
[4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate (PubChem CID 155805536) has the molecular formula C32H38N2O4
and a molecular weight of 514.67 g/mol. Its IUPAC name is [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate |
| PubChem CID | 155805536 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc(/C(=C(/CC)Cc2ccccc2)c2ccc(OCCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C32H38N2O4/c1-3-26(24-25-8-6-5-7-9-25)31(28-12-16-30(17-13-28)38-32(35)33-4-2)27-10-14-29(15-11-27)37-23-20-34-18-21-36-22-19-34/h5-17H,3-4,18-24H2,1-2H3,(H,33,35)/b31-26- |
| InChIKey | SBGMUNNMJOEMFN-ZXPTYKNPSA-N |
| XLogP | 5.96 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate?
The IUPAC name of [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate (CID 155805536) is [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate.
What is the SMILES notation for [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate?
The canonical SMILES for [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate is CCNC(=O)Oc1ccc(/C(=C(/CC)Cc2ccccc2)c2ccc(OCCN3CCOCC3)cc2)cc1.
What is the InChIKey of [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate?
The InChIKey is SBGMUNNMJOEMFN-ZXPTYKNPSA-N. The full InChI is InChI=1S/C32H38N2O4/c1-3-26(24-25-8-6-5-7-9-25)31(28-12-16-30(17-13-28)38-32(35)33-4-2)27-10-14-29(15-11-27)37-23-20-34-18-21-36-22-19-34/h5-17H,3-4,18-24H2,1-2H3,(H,33,35)/b31-26-.
What are the key properties of [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate?
[4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate has a molecular weight of 514.67 g/mol, XLogP of 5.96, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(Z)-2-benzyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]but-1-enyl]phenyl] N-ethylcarbamate is sourced from PubChem (CID 155805536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).