C19H25N5O3 — CID 155805682
6-N-(3,5-dimethylphenyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine (PubChem CID 155805682) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 6-N-(3,5-dimethylphenyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-(3,5-dimethylphenyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 155805682 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 6-N-(3,5-dimethylphenyl)-2-N-(2-morpholin-4-ylethyl)-3-nitropyridine-2,6-diamine |
| SMILES | Cc1cc(C)cc(Nc2ccc([N+](=O)[O-])c(NCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C19H25N5O3/c1-14-11-15(2)13-16(12-14)21-18-4-3-17(24(25)26)19(22-18)20-5-6-23-7-9-27-10-8-23/h3-4,11-13H,5-10H2,1-2H3,(H2,20,21,22) |
| InChIKey | UIZNRSGQTXFMOF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|