C16H22O2 — CID 155805887
(6R,8aS,10aR)-6,9,9-trimethyl-5,6,7,8,8a,10a-hexahydroxanthen-3-ol (PubChem CID 155805887) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (6R,8aS,10aR)-6,9,9-trimethyl-5,6,7,8,8a,10a-hexahydroxanthen-3-ol.
| Compound Name | (6R,8aS,10aR)-6,9,9-trimethyl-5,6,7,8,8a,10a-hexahydroxanthen-3-ol |
|---|---|
| PubChem CID | 155805887 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (6R,8aS,10aR)-6,9,9-trimethyl-5,6,7,8,8a,10a-hexahydroxanthen-3-ol |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)Oc1cc(O)ccc1C2(C)C |
| InChI | InChI=1S/C16H22O2/c1-10-4-6-12-14(8-10)18-15-9-11(17)5-7-13(15)16(12,2)3/h5,7,9-10,12,14,17H,4,6,8H2,1-3H3/t10-,12-,14-/m1/s1 |
| InChIKey | ZGENTKDVAFBWKO-MPKXVKKWSA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |