About 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine
9-chloro-1H-indolo[2,3-b][1,5]naphthyridine (PubChem CID 155806048) has the molecular formula C14H8ClN3
and a molecular weight of 253.69 g/mol. Its IUPAC name is 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine.
Molecular Properties
| Compound Name | 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine |
| PubChem CID | 155806048 |
| Molecular Formula | C14H8ClN3 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine |
| SMILES | Clc1ccc2nc3nc4ccc[nH]c4cc3c2c1 |
| InChI | InChI=1S/C14H8ClN3/c15-8-3-4-11-9(6-8)10-7-13-12(2-1-5-16-13)18-14(10)17-11/h1-7,16H |
| InChIKey | GHCZIXHYOSMMGS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine?
The IUPAC name of 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine (CID 155806048) is 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine.
What is the SMILES notation for 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine?
The canonical SMILES for 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine is Clc1ccc2nc3nc4ccc[nH]c4cc3c2c1.
What is the InChIKey of 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine?
The InChIKey is GHCZIXHYOSMMGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClN3/c15-8-3-4-11-9(6-8)10-7-13-12(2-1-5-16-13)18-14(10)17-11/h1-7,16H.
What are the key properties of 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine?
9-chloro-1H-indolo[2,3-b][1,5]naphthyridine has a molecular weight of 253.69 g/mol, XLogP of 3.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-1H-indolo[2,3-b][1,5]naphthyridine is sourced from PubChem (CID 155806048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).