C18H10Cl2N2OS — CID 155806273
5,7-bis(4-chlorophenyl)-3H-[1,3]thiazolo[4,5-b]pyridin-2-one (PubChem CID 155806273) has the molecular formula C18H10Cl2N2OS and a molecular weight of 373.26 g/mol. Its IUPAC name is 5,7-bis(4-chlorophenyl)-3H-[1,3]thiazolo[4,5-b]pyridin-2-one.
| Compound Name | 5,7-bis(4-chlorophenyl)-3H-[1,3]thiazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 155806273 |
| Molecular Formula | C18H10Cl2N2OS |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 5,7-bis(4-chlorophenyl)-3H-[1,3]thiazolo[4,5-b]pyridin-2-one |
| SMILES | O=c1[nH]c2nc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)c2s1 |
| InChI | InChI=1S/C18H10Cl2N2OS/c19-12-5-1-10(2-6-12)14-9-15(11-3-7-13(20)8-4-11)21-17-16(14)24-18(23)22-17/h1-9H,(H,21,22,23) |
| InChIKey | NVRMQODQTZICQC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |