C19H17NO5 — CID 155806397
2-(2-hydroxyethyl)-6-methoxy-4,10-dimethyl-[1]benzofuro[3,2-f]isoindole-1,3-dione (PubChem CID 155806397) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-6-methoxy-4,10-dimethyl-[1]benzofuro[3,2-f]isoindole-1,3-dione.
| Compound Name | 2-(2-hydroxyethyl)-6-methoxy-4,10-dimethyl-[1]benzofuro[3,2-f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155806397 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-(2-hydroxyethyl)-6-methoxy-4,10-dimethyl-[1]benzofuro[3,2-f]isoindole-1,3-dione |
| SMILES | COc1ccc2oc3c(C)c4c(c(C)c3c2c1)C(=O)N(CCO)C4=O |
| InChI | InChI=1S/C19H17NO5/c1-9-14-12-8-11(24-3)4-5-13(12)25-17(14)10(2)16-15(9)18(22)20(6-7-21)19(16)23/h4-5,8,21H,6-7H2,1-3H3 |
| InChIKey | BVLLJHWMQLIGQW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|