C23H38N2O2 — CID 155806569
2-[4-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperazin-1-yl]ethanol (PubChem CID 155806569) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 2-[4-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 155806569 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | 2-[4-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperazin-1-yl]ethanol |
| SMILES | C/C(=C\CCc1ccoc1)CC/C=C(\C)CCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C23H38N2O2/c1-21(8-4-10-23-11-19-27-20-23)6-3-7-22(2)9-5-12-24-13-15-25(16-14-24)17-18-26/h7-8,11,19-20,26H,3-6,9-10,12-18H2,1-2H3/b21-8+,22-7+ |
| InChIKey | DXQXUMVAAIXZPE-JEPCQTPVSA-N |
| XLogP | 4.28 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|