C27H39NO4S — CID 155806606
ethyl (2E,6E,10E)-13-(furan-3-yl)-6,10-dimethyl-2-(2-oxo-2-thiomorpholin-4-ylethyl)trideca-2,6,10-trienoate (PubChem CID 155806606) has the molecular formula C27H39NO4S and a molecular weight of 473.68 g/mol. Its IUPAC name is ethyl (2E,6E,10E)-13-(furan-3-yl)-6,10-dimethyl-2-(2-oxo-2-thiomorpholin-4-ylethyl)trideca-2,6,10-trienoate.
| Compound Name | ethyl (2E,6E,10E)-13-(furan-3-yl)-6,10-dimethyl-2-(2-oxo-2-thiomorpholin-4-ylethyl)trideca-2,6,10-trienoate |
|---|---|
| PubChem CID | 155806606 |
| Molecular Formula | C27H39NO4S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | ethyl (2E,6E,10E)-13-(furan-3-yl)-6,10-dimethyl-2-(2-oxo-2-thiomorpholin-4-ylethyl)trideca-2,6,10-trienoate |
| SMILES | CCOC(=O)/C(=C/CC/C(C)=C/CC/C(C)=C/CCc1ccoc1)CC(=O)N1CCSCC1 |
| InChI | InChI=1S/C27H39NO4S/c1-4-32-27(30)25(20-26(29)28-15-18-33-19-16-28)13-7-11-23(3)9-5-8-22(2)10-6-12-24-14-17-31-21-24/h9-10,13-14,17,21H,4-8,11-12,15-16,18-20H2,1-3H3/b22-10+,23-9+,25-13+ |
| InChIKey | LSHMWZPNQQRBAL-XKVBZILTSA-N |
| XLogP | 6.12 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|