C24H18Cl2N4OS — CID 155806660
N-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 155806660) has the molecular formula C24H18Cl2N4OS and a molecular weight of 481.41 g/mol. Its IUPAC name is N-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | N-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 155806660 |
| Molecular Formula | C24H18Cl2N4OS |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | N-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Cc1cc(C)c2c(n1)sc1c(Nc3ccc(OCc4ccc(Cl)c(Cl)c4)cc3)ncnc12 |
| InChI | InChI=1S/C24H18Cl2N4OS/c1-13-9-14(2)29-24-20(13)21-22(32-24)23(28-12-27-21)30-16-4-6-17(7-5-16)31-11-15-3-8-18(25)19(26)10-15/h3-10,12H,11H2,1-2H3,(H,27,28,30) |
| InChIKey | VOSMKJOEFBEIHZ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |