C22H25N7O3S2 — CID 155806722
N-[2-(4,4-dimethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine (PubChem CID 155806722) has the molecular formula C22H25N7O3S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[2-(4,4-dimethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | N-[2-(4,4-dimethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 155806722 |
| Molecular Formula | C22H25N7O3S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | N-[2-(4,4-dimethyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethyl]-4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-amine |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCN3CC(C)(C)NS3(=O)=O)n2)c1 |
| InChI | InChI=1S/C22H25N7O3S2/c1-22(2)14-28(34(30,31)27-22)10-9-24-20-23-8-7-17(25-20)19-18(26-21-29(19)11-12-33-21)15-5-4-6-16(13-15)32-3/h4-8,11-13,27H,9-10,14H2,1-3H3,(H,23,24,25) |
| InChIKey | WMWAPZMXZNHBPR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |