C23H33NO5 — CID 155806746
[(3S,6E,17S)-17-acetyloxy-6-hydroxyimino-10,13-dimethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 155806746) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is [(3S,6E,17S)-17-acetyloxy-6-hydroxyimino-10,13-dimethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,6E,17S)-17-acetyloxy-6-hydroxyimino-10,13-dimethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 155806746 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | [(3S,6E,17S)-17-acetyloxy-6-hydroxyimino-10,13-dimethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C2/C(=N/O)CC3C(CCC4(C)C3CC[C@@H]4OC(C)=O)C2(C)CC1 |
| InChI | InChI=1S/C23H33NO5/c1-13(25)28-15-7-9-22(3)18-8-10-23(4)17(5-6-21(23)29-14(2)26)16(18)12-20(24-27)19(22)11-15/h11,15-18,21,27H,5-10,12H2,1-4H3/b24-20+/t15-,16?,17?,18?,21-,22?,23?/m0/s1 |
| InChIKey | KHRDZKCXVITDEA-HGAXZQGNSA-N |
| XLogP | 4.25 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|