About 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline
4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline (PubChem CID 155806764) has the molecular formula C18H12N2O2
and a molecular weight of 288.31 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline |
| PubChem CID | 155806764 |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline |
| SMILES | c1ccc2c(c1)nc(-c1ccc3c(c1)OCO3)c1cccn12 |
| InChI | InChI=1S/C18H12N2O2/c1-2-5-14-13(4-1)19-18(15-6-3-9-20(14)15)12-7-8-16-17(10-12)22-11-21-16/h1-10H,11H2 |
| InChIKey | FSBREUCQDRLQNK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline?
The IUPAC name of 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline (CID 155806764) is 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline.
What is the SMILES notation for 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline?
The canonical SMILES for 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline is c1ccc2c(c1)nc(-c1ccc3c(c1)OCO3)c1cccn12.
What is the InChIKey of 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline?
The InChIKey is FSBREUCQDRLQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2/c1-2-5-14-13(4-1)19-18(15-6-3-9-20(14)15)12-7-8-16-17(10-12)22-11-21-16/h1-10H,11H2.
What are the key properties of 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline?
4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline has a molecular weight of 288.31 g/mol, XLogP of 3.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-yl)pyrrolo[1,2-a]quinoxaline is sourced from PubChem (CID 155806764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).