C22H22N2O4S — CID 155806775
methyl 2-[(3R,8aR)-5,8-dioxo-3-phenyl-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]-3-phenylpropanoate (PubChem CID 155806775) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is methyl 2-[(3R,8aR)-5,8-dioxo-3-phenyl-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]-3-phenylpropanoate.
| Compound Name | methyl 2-[(3R,8aR)-5,8-dioxo-3-phenyl-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 155806775 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | methyl 2-[(3R,8aR)-5,8-dioxo-3-phenyl-1,3,6,8a-tetrahydro-[1,3]thiazolo[3,4-a]pyrazin-7-yl]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)N1CC(=O)N2[C@@H](c3ccccc3)SC[C@H]2C1=O |
| InChI | InChI=1S/C22H22N2O4S/c1-28-22(27)17(12-15-8-4-2-5-9-15)23-13-19(25)24-18(20(23)26)14-29-21(24)16-10-6-3-7-11-16/h2-11,17-18,21H,12-14H2,1H3/t17?,18-,21+/m0/s1 |
| InChIKey | NNYNNEHQSZESMH-MVDKKGTRSA-N |
| XLogP | 2.26 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |