About 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine
9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine (PubChem CID 155807168) has the molecular formula C13H9BrClN5O2
and a molecular weight of 382.61 g/mol. Its IUPAC name is 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine.
Molecular Properties
| Compound Name | 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine |
| PubChem CID | 155807168 |
| Molecular Formula | C13H9BrClN5O2 |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine |
| SMILES | Nc1nc(Cl)c2ncn(Cc3cc4c(cc3Br)OCO4)c2n1 |
| InChI | InChI=1S/C13H9BrClN5O2/c14-7-2-9-8(21-5-22-9)1-6(7)3-20-4-17-10-11(15)18-13(16)19-12(10)20/h1-2,4H,3,5H2,(H2,16,18,19) |
| InChIKey | RQADLKGXUPIZTQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine?
The IUPAC name of 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine (CID 155807168) is 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine.
What is the SMILES notation for 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine?
The canonical SMILES for 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine is Nc1nc(Cl)c2ncn(Cc3cc4c(cc3Br)OCO4)c2n1.
What is the InChIKey of 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine?
The InChIKey is RQADLKGXUPIZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrClN5O2/c14-7-2-9-8(21-5-22-9)1-6(7)3-20-4-17-10-11(15)18-13(16)19-12(10)20/h1-2,4H,3,5H2,(H2,16,18,19).
What are the key properties of 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine?
9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine has a molecular weight of 382.61 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-6-chloropurin-2-amine is sourced from PubChem (CID 155807168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).