C19H9NO4 — CID 155807377
12-oxa-20-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18-octaene-3,10,21-trione (PubChem CID 155807377) has the molecular formula C19H9NO4 and a molecular weight of 315.28 g/mol. Its IUPAC name is 12-oxa-20-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18-octaene-3,10,21-trione.
| Compound Name | 12-oxa-20-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18-octaene-3,10,21-trione |
|---|---|
| PubChem CID | 155807377 |
| Molecular Formula | C19H9NO4 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 12-oxa-20-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2(11),4,6,8,14,16,18-octaene-3,10,21-trione |
| SMILES | O=C1c2ccccc2C(=O)c2c1oc1c2c(=O)[nH]c2ccccc21 |
| InChI | InChI=1S/C19H9NO4/c21-15-9-5-1-2-6-10(9)16(22)18-13(15)14-17(24-18)11-7-3-4-8-12(11)20-19(14)23/h1-8H,(H,20,23) |
| InChIKey | BHHAZDIQNDDBBW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|