C20H22N4OS — CID 155807823
4-(4-morpholin-4-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)aniline (PubChem CID 155807823) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 4-(4-morpholin-4-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)aniline.
| Compound Name | 4-(4-morpholin-4-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)aniline |
|---|---|
| PubChem CID | 155807823 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-(4-morpholin-4-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)aniline |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)c3c4c(sc3n2)CCCC4)cc1 |
| InChI | InChI=1S/C20H22N4OS/c21-14-7-5-13(6-8-14)18-22-19(24-9-11-25-12-10-24)17-15-3-1-2-4-16(15)26-20(17)23-18/h5-8H,1-4,9-12,21H2 |
| InChIKey | YVBCAFJNGHZFHZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|