C21H33NO — CID 155808430
1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]pyrrolidine (PubChem CID 155808430) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]pyrrolidine.
| Compound Name | 1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]pyrrolidine |
|---|---|
| PubChem CID | 155808430 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]pyrrolidine |
| SMILES | C/C(=C\CCc1ccoc1)CC/C=C(\C)CCCN1CCCC1 |
| InChI | InChI=1S/C21H33NO/c1-19(10-6-12-21-13-17-23-18-21)8-5-9-20(2)11-7-16-22-14-3-4-15-22/h9-10,13,17-18H,3-8,11-12,14-16H2,1-2H3/b19-10+,20-9+ |
| InChIKey | ADBUKNUICSNFMT-HURGCPBHSA-N |
| XLogP | 5.76 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|