C36H26N4O6 — CID 155808632
5-(1H-benzimidazol-2-yl)-2-[5-(1H-benzimidazol-2-yl)-1,6,7-trihydroxy-3-methylnaphthalen-2-yl]-3-methylnaphthalene-1,6,7-triol (PubChem CID 155808632) has the molecular formula C36H26N4O6 and a molecular weight of 610.63 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-yl)-2-[5-(1H-benzimidazol-2-yl)-1,6,7-trihydroxy-3-methylnaphthalen-2-yl]-3-methylnaphthalene-1,6,7-triol.
| Compound Name | 5-(1H-benzimidazol-2-yl)-2-[5-(1H-benzimidazol-2-yl)-1,6,7-trihydroxy-3-methylnaphthalen-2-yl]-3-methylnaphthalene-1,6,7-triol |
|---|---|
| PubChem CID | 155808632 |
| Molecular Formula | C36H26N4O6 |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 5-(1H-benzimidazol-2-yl)-2-[5-(1H-benzimidazol-2-yl)-1,6,7-trihydroxy-3-methylnaphthalen-2-yl]-3-methylnaphthalene-1,6,7-triol |
| SMILES | Cc1cc2c(-c3nc4ccccc4[nH]3)c(O)c(O)cc2c(O)c1-c1c(C)cc2c(-c3nc4ccccc4[nH]3)c(O)c(O)cc2c1O |
| InChI | InChI=1S/C36H26N4O6/c1-15-11-17-19(13-25(41)33(45)29(17)35-37-21-7-3-4-8-22(21)38-35)31(43)27(15)28-16(2)12-18-20(32(28)44)14-26(42)34(46)30(18)36-39-23-9-5-6-10-24(23)40-36/h3-14,41-46H,1-2H3,(H,37,38)(H,39,40) |
| InChIKey | GAIUVLLBLNSBDL-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|