C23H32O4 — CID 155809003
methyl (Z)-6-[(1R,5E)-5-[(3S,5Z,8Z)-3-hydroxyundeca-5,8-dienylidene]-4-oxocyclopent-2-en-1-yl]hex-4-enoate (PubChem CID 155809003) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is methyl (Z)-6-[(1R,5E)-5-[(3S,5Z,8Z)-3-hydroxyundeca-5,8-dienylidene]-4-oxocyclopent-2-en-1-yl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(1R,5E)-5-[(3S,5Z,8Z)-3-hydroxyundeca-5,8-dienylidene]-4-oxocyclopent-2-en-1-yl]hex-4-enoate |
|---|---|
| PubChem CID | 155809003 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | methyl (Z)-6-[(1R,5E)-5-[(3S,5Z,8Z)-3-hydroxyundeca-5,8-dienylidene]-4-oxocyclopent-2-en-1-yl]hex-4-enoate |
| SMILES | CC/C=C\C/C=C\C[C@H](O)C/C=C1/C(=O)C=C[C@H]1C/C=C\CCC(=O)OC |
| InChI | InChI=1S/C23H32O4/c1-3-4-5-6-7-10-13-20(24)16-17-21-19(15-18-22(21)25)12-9-8-11-14-23(26)27-2/h4-5,7-10,15,17-20,24H,3,6,11-14,16H2,1-2H3/b5-4-,9-8-,10-7-,21-17+/t19-,20+/m1/s1 |
| InChIKey | VAEBIJWZHXCAIK-DVNYHINMSA-N |
| XLogP | 4.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|