C30H23F3N8O2 — CID 155809566
6-(1,3-benzodioxol-5-yl)-8-[3-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepine-2,4-diamine (PubChem CID 155809566) has the molecular formula C30H23F3N8O2 and a molecular weight of 584.56 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-8-[3-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepine-2,4-diamine.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-8-[3-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepine-2,4-diamine |
|---|---|
| PubChem CID | 155809566 |
| Molecular Formula | C30H23F3N8O2 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-8-[3-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenyl]-8,9-dihydro-7H-pyrimido[4,5-b][1,4]diazepine-2,4-diamine |
| SMILES | Nc1nc(N)c2c(n1)NC(c1cccc(Nc3ccnc4cc(C(F)(F)F)ccc34)c1)CC(c1ccc3c(c1)OCO3)=N2 |
| InChI | InChI=1S/C30H23F3N8O2/c31-30(32,33)17-5-6-19-20(8-9-36-23(19)12-17)37-18-3-1-2-15(10-18)22-13-21(16-4-7-24-25(11-16)43-14-42-24)38-26-27(34)40-29(35)41-28(26)39-22/h1-12,22H,13-14H2,(H,36,37)(H5,34,35,39,40,41) |
| InChIKey | KEJRCIDOHCKCNV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 145.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |