C33H33F12N7O5 — CID 155809843
methyl (2S)-2-[[(2S)-2,6-bis[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]hexanoyl]amino]-3-(1-ethylimidazol-4-yl)propanoate (PubChem CID 155809843) has the molecular formula C33H33F12N7O5 and a molecular weight of 835.65 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2,6-bis[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]hexanoyl]amino]-3-(1-ethylimidazol-4-yl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2,6-bis[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]hexanoyl]amino]-3-(1-ethylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 155809843 |
| Molecular Formula | C33H33F12N7O5 |
| Molecular Weight | 835.65 g/mol |
| Exact Mass | 835.24 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2,6-bis[[3,5-bis(trifluoromethyl)phenyl]carbamoylamino]hexanoyl]amino]-3-(1-ethylimidazol-4-yl)propanoate |
| SMILES | CCn1cnc(C[C@H](NC(=O)[C@H](CCCCNC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)OC)c1 |
| InChI | InChI=1S/C33H33F12N7O5/c1-3-52-15-23(47-16-52)14-25(27(54)57-2)50-26(53)24(51-29(56)49-22-12-19(32(40,41)42)9-20(13-22)33(43,44)45)6-4-5-7-46-28(55)48-21-10-17(30(34,35)36)8-18(11-21)31(37,38)39/h8-13,15-16,24-25H,3-7,14H2,1-2H3,(H,50,53)(H2,46,48,55)(H2,49,51,56)/t24-,25-/m0/s1 |
| InChIKey | JWBCKODSJMCGNX-DQEYMECFSA-N |
| XLogP | 7.36 |
| TPSA | 155.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.65 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|