About [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol
[2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol (PubChem CID 155809850) has the molecular formula C16H15ClFNO
and a molecular weight of 291.75 g/mol. Its IUPAC name is [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol |
| PubChem CID | 155809850 |
| Molecular Formula | C16H15ClFNO |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol |
| SMILES | OCc1ccc(N2CCc3cccc(F)c3C2)cc1Cl |
| InChI | InChI=1S/C16H15ClFNO/c17-15-8-13(5-4-12(15)10-20)19-7-6-11-2-1-3-16(18)14(11)9-19/h1-5,8,20H,6-7,9-10H2 |
| InChIKey | JIEPRXXJEWVKGW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol?
The IUPAC name of [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol (CID 155809850) is [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol.
What is the SMILES notation for [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol?
The canonical SMILES for [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol is OCc1ccc(N2CCc3cccc(F)c3C2)cc1Cl.
What is the InChIKey of [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol?
The InChIKey is JIEPRXXJEWVKGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClFNO/c17-15-8-13(5-4-12(15)10-20)19-7-6-11-2-1-3-16(18)14(11)9-19/h1-5,8,20H,6-7,9-10H2.
What are the key properties of [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol?
[2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol has a molecular weight of 291.75 g/mol, XLogP of 3.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-4-(8-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)phenyl]methanol is sourced from PubChem (CID 155809850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).