C26H31N7O5S2 — CID 155809871
tert-butyl 6-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate (PubChem CID 155809871) has the molecular formula C26H31N7O5S2 and a molecular weight of 585.71 g/mol. Its IUPAC name is tert-butyl 6-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate.
| Compound Name | tert-butyl 6-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate |
|---|---|
| PubChem CID | 155809871 |
| Molecular Formula | C26H31N7O5S2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | tert-butyl 6-[2-[[4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-1,1-dioxo-1,2,6-thiadiazinane-2-carboxylate |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(NCCN3CCCN(C(=O)OC(C)(C)C)S3(=O)=O)n2)c1 |
| InChI | InChI=1S/C26H31N7O5S2/c1-26(2,3)38-25(34)33-13-6-12-31(40(33,35)36)14-11-28-23-27-10-9-20(29-23)22-21(30-24-32(22)15-16-39-24)18-7-5-8-19(17-18)37-4/h5,7-10,15-17H,6,11-14H2,1-4H3,(H,27,28,29) |
| InChIKey | ZWRBBJOOCODFQA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |