About 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole
3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole (PubChem CID 155810036) has the molecular formula C24H14ClFN4
and a molecular weight of 412.86 g/mol. Its IUPAC name is 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole |
| PubChem CID | 155810036 |
| Molecular Formula | C24H14ClFN4 |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole |
| SMILES | Fc1ccc(-c2nc(-c3nc4ccc(Cl)cc4[nH]3)cc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C24H14ClFN4/c25-14-7-10-19-20(11-14)30-24(29-19)21-12-17-16-3-1-2-4-18(16)27-23(17)22(28-21)13-5-8-15(26)9-6-13/h1-12,27H,(H,29,30) |
| InChIKey | QCTDBBGROYUUOS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole?
The IUPAC name of 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole (CID 155810036) is 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole?
The canonical SMILES for 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole is Fc1ccc(-c2nc(-c3nc4ccc(Cl)cc4[nH]3)cc3c2[nH]c2ccccc23)cc1.
What is the InChIKey of 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole?
The InChIKey is QCTDBBGROYUUOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14ClFN4/c25-14-7-10-19-20(11-14)30-24(29-19)21-12-17-16-3-1-2-4-18(16)27-23(17)22(28-21)13-5-8-15(26)9-6-13/h1-12,27H,(H,29,30).
What are the key properties of 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole?
3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole has a molecular weight of 412.86 g/mol, XLogP of 6.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-chloro-1H-benzimidazol-2-yl)-1-(4-fluorophenyl)-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 155810036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).