C21H15BrN4 — CID 155810163
11-(3-bromophenyl)-11,12-dihydropyrido[4,3-c][1,8]phenanthrolin-6-amine (PubChem CID 155810163) has the molecular formula C21H15BrN4 and a molecular weight of 403.28 g/mol. Its IUPAC name is 11-(3-bromophenyl)-11,12-dihydropyrido[4,3-c][1,8]phenanthrolin-6-amine.
| Compound Name | 11-(3-bromophenyl)-11,12-dihydropyrido[4,3-c][1,8]phenanthrolin-6-amine |
|---|---|
| PubChem CID | 155810163 |
| Molecular Formula | C21H15BrN4 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 11-(3-bromophenyl)-11,12-dihydropyrido[4,3-c][1,8]phenanthrolin-6-amine |
| SMILES | Nc1nc2c(c3cnccc13)C(c1cccc(Br)c1)Cc1cnccc1-2 |
| InChI | InChI=1S/C21H15BrN4/c22-14-3-1-2-12(8-14)17-9-13-10-24-6-4-15(13)20-19(17)18-11-25-7-5-16(18)21(23)26-20/h1-8,10-11,17H,9H2,(H2,23,26) |
| InChIKey | LIRYCWARRXNXFD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |