C15H12F4O2 — CID 155810376
2-cyclohexyl-4,5,6,7-tetrafluoroindene-1,3-dione (PubChem CID 155810376) has the molecular formula C15H12F4O2 and a molecular weight of 300.25 g/mol. Its IUPAC name is 2-cyclohexyl-4,5,6,7-tetrafluoroindene-1,3-dione.
| Compound Name | 2-cyclohexyl-4,5,6,7-tetrafluoroindene-1,3-dione |
|---|---|
| PubChem CID | 155810376 |
| Molecular Formula | C15H12F4O2 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-cyclohexyl-4,5,6,7-tetrafluoroindene-1,3-dione |
| SMILES | O=C1c2c(F)c(F)c(F)c(F)c2C(=O)C1C1CCCCC1 |
| InChI | InChI=1S/C15H12F4O2/c16-10-8-9(11(17)13(19)12(10)18)15(21)7(14(8)20)6-4-2-1-3-5-6/h6-7H,1-5H2 |
| InChIKey | AYOUGRTZKIQWRX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|