C36H20N4O2 — CID 155810636
2-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 155810636) has the molecular formula C36H20N4O2 and a molecular weight of 540.58 g/mol. Its IUPAC name is 2-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 2-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 155810636 |
| Molecular Formula | C36H20N4O2 |
| Molecular Weight | 540.58 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 2-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1[nH]c(-c3ccc(-c4nc5c6ccccc6c6ccccc6c5[nH]4)cc3)nc21 |
| InChI | InChI=1S/C36H20N4O2/c41-33-25-11-5-6-12-26(25)34(42)29-27(33)17-18-28-32(29)40-35(37-28)19-13-15-20(16-14-19)36-38-30-23-9-3-1-7-21(23)22-8-2-4-10-24(22)31(30)39-36/h1-18H,(H,37,40)(H,38,39) |
| InChIKey | ZEFQYOSSRRRIMZ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|