C19H25NO3 — CID 155810833
[(3R,5S)-5-(furan-3-yl)-3-phenylhexyl] N,N-dimethylcarbamate (PubChem CID 155810833) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is [(3R,5S)-5-(furan-3-yl)-3-phenylhexyl] N,N-dimethylcarbamate.
| Compound Name | [(3R,5S)-5-(furan-3-yl)-3-phenylhexyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 155810833 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [(3R,5S)-5-(furan-3-yl)-3-phenylhexyl] N,N-dimethylcarbamate |
| SMILES | C[C@@H](C[C@H](CCOC(=O)N(C)C)c1ccccc1)c1ccoc1 |
| InChI | InChI=1S/C19H25NO3/c1-15(18-9-11-22-14-18)13-17(16-7-5-4-6-8-16)10-12-23-19(21)20(2)3/h4-9,11,14-15,17H,10,12-13H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | SXDPGWGUFWSWOL-RDJZCZTQSA-N |
| XLogP | 4.65 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |