C30H26N6O — CID 155810976
1',6-dimethyl-8-(4-methylphenyl)-4-phenylspiro[2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-12,3'-indole]-2'-one (PubChem CID 155810976) has the molecular formula C30H26N6O and a molecular weight of 486.58 g/mol. Its IUPAC name is 1',6-dimethyl-8-(4-methylphenyl)-4-phenylspiro[2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-12,3'-indole]-2'-one.
| Compound Name | 1',6-dimethyl-8-(4-methylphenyl)-4-phenylspiro[2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-12,3'-indole]-2'-one |
|---|---|
| PubChem CID | 155810976 |
| Molecular Formula | C30H26N6O |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 1',6-dimethyl-8-(4-methylphenyl)-4-phenylspiro[2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-12,3'-indole]-2'-one |
| SMILES | Cc1ccc(-c2c3c(nc4c2c(C)nn4-c2ccccc2)NC2(NC3)C(=O)N(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H26N6O/c1-18-13-15-20(16-14-18)26-22-17-31-30(23-11-7-8-12-24(23)35(3)29(30)37)33-27(22)32-28-25(26)19(2)34-36(28)21-9-5-4-6-10-21/h4-16,31H,17H2,1-3H3,(H,32,33) |
| InChIKey | HZISIJRMJJUWPS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |