C39H30Cl2N2O5 — CID 155811126
10-[3-[4-[(Z)-[1-(2,6-dichlorophenyl)-2-oxoindol-3-ylidene]methyl]-2,6-dimethoxyphenoxy]propyl]acridin-9-one (PubChem CID 155811126) has the molecular formula C39H30Cl2N2O5 and a molecular weight of 677.58 g/mol. Its IUPAC name is 10-[3-[4-[(Z)-[1-(2,6-dichlorophenyl)-2-oxoindol-3-ylidene]methyl]-2,6-dimethoxyphenoxy]propyl]acridin-9-one.
| Compound Name | 10-[3-[4-[(Z)-[1-(2,6-dichlorophenyl)-2-oxoindol-3-ylidene]methyl]-2,6-dimethoxyphenoxy]propyl]acridin-9-one |
|---|---|
| PubChem CID | 155811126 |
| Molecular Formula | C39H30Cl2N2O5 |
| Molecular Weight | 677.58 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | 10-[3-[4-[(Z)-[1-(2,6-dichlorophenyl)-2-oxoindol-3-ylidene]methyl]-2,6-dimethoxyphenoxy]propyl]acridin-9-one |
| SMILES | COc1cc(/C=C2\C(=O)N(c3c(Cl)cccc3Cl)c3ccccc32)cc(OC)c1OCCCn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C39H30Cl2N2O5/c1-46-34-22-24(21-28-25-11-3-8-18-33(25)43(39(28)45)36-29(40)14-9-15-30(36)41)23-35(47-2)38(34)48-20-10-19-42-31-16-6-4-12-26(31)37(44)27-13-5-7-17-32(27)42/h3-9,11-18,21-23H,10,19-20H2,1-2H3/b28-21- |
| InChIKey | LUSBQTNEAZPOOR-HFTWOUSFSA-N |
| XLogP | 9.17 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.58 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|