About 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol
3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol (PubChem CID 15581165) has the molecular formula C16H15FOS
and a molecular weight of 274.36 g/mol. Its IUPAC name is 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol.
Molecular Properties
| Compound Name | 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol |
| PubChem CID | 15581165 |
| Molecular Formula | C16H15FOS |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol |
| SMILES | CCc1ccc2c(c1)C(O)Cc1ccc(F)cc1S2 |
| InChI | InChI=1S/C16H15FOS/c1-2-10-3-6-15-13(7-10)14(18)8-11-4-5-12(17)9-16(11)19-15/h3-7,9,14,18H,2,8H2,1H3 |
| InChIKey | QGVOIRAGJFDQOB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol?
The IUPAC name of 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol (CID 15581165) is 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol.
What is the SMILES notation for 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol?
The canonical SMILES for 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol is CCc1ccc2c(c1)C(O)Cc1ccc(F)cc1S2.
What is the InChIKey of 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol?
The InChIKey is QGVOIRAGJFDQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FOS/c1-2-10-3-6-15-13(7-10)14(18)8-11-4-5-12(17)9-16(11)19-15/h3-7,9,14,18H,2,8H2,1H3.
What are the key properties of 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol?
3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol has a molecular weight of 274.36 g/mol, XLogP of 4.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-9-fluoro-5,6-dihydrobenzo[b][1]benzothiepin-5-ol is sourced from PubChem (CID 15581165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).