C25H30F6N6O3 — CID 155811729
(3S)-3-(2-methylpropyl)-N'-[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]pentanediamide (PubChem CID 155811729) has the molecular formula C25H30F6N6O3 and a molecular weight of 576.54 g/mol. Its IUPAC name is (3S)-3-(2-methylpropyl)-N'-[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]pentanediamide.
| Compound Name | (3S)-3-(2-methylpropyl)-N'-[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 155811729 |
| Molecular Formula | C25H30F6N6O3 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | (3S)-3-(2-methylpropyl)-N'-[(2R)-4-oxo-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1-(2,4,5-trifluorophenyl)butan-2-yl]pentanediamide |
| SMILES | CC(C)C[C@@H](CC(N)=O)CC(=O)N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C25H30F6N6O3/c1-13(2)5-14(6-20(32)38)7-22(39)33-16(8-15-9-18(27)19(28)11-17(15)26)10-23(40)36-3-4-37-21(12-36)34-35-24(37)25(29,30)31/h9,11,13-14,16H,3-8,10,12H2,1-2H3,(H2,32,38)(H,33,39)/t14-,16+/m0/s1 |
| InChIKey | MATJRUSNFWBXLE-GOEBONIOSA-N |
| XLogP | 3.10 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|