C12H18O3S — CID 155811811
(3R,4R,5S,6R)-3,4,8,9-tetramethyl-6-oxo-2-oxa-6λ4-thiaspiro[4.5]dec-8-en-1-one (PubChem CID 155811811) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3,4,8,9-tetramethyl-6-oxo-2-oxa-6λ4-thiaspiro[4.5]dec-8-en-1-one.
| Compound Name | (3R,4R,5S,6R)-3,4,8,9-tetramethyl-6-oxo-2-oxa-6λ4-thiaspiro[4.5]dec-8-en-1-one |
|---|---|
| PubChem CID | 155811811 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (3R,4R,5S,6R)-3,4,8,9-tetramethyl-6-oxo-2-oxa-6λ4-thiaspiro[4.5]dec-8-en-1-one |
| SMILES | CC1=C(C)C[C@]2(C(=O)O[C@H](C)[C@H]2C)[S@](=O)C1 |
| InChI | InChI=1S/C12H18O3S/c1-7-5-12(16(14)6-8(7)2)9(3)10(4)15-11(12)13/h9-10H,5-6H2,1-4H3/t9-,10-,12+,16-/m1/s1 |
| InChIKey | VOCLTDPJMIQCDJ-CDGODJOISA-N |
| XLogP | 1.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|